C23H26FN3O4S — CID 1044944
(6S)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 1044944) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is (6S)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | (6S)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 1044944 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (6S)-3-[2-(3,4-diethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | CCOc1ccc(CCN2C(=O)C[C@@H](C(N)=O)S/C2=N\c2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C23H26FN3O4S/c1-3-30-18-10-5-15(13-19(18)31-4-2)11-12-27-21(28)14-20(22(25)29)32-23(27)26-17-8-6-16(24)7-9-17/h5-10,13,20H,3-4,11-12,14H2,1-2H3,(H2,25,29)/b26-23-/t20-/m0/s1 |
| InChIKey | YWAQKOBSDCURTP-UOODYVSWSA-N |
| XLogP | 3.67 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|