C26H21NO — CID 10451361
(5Z)-5-(1-anilinoethylidene)-4-methylidene-2,3-diphenylcyclopent-2-en-1-one (PubChem CID 10451361) has the molecular formula C26H21NO and a molecular weight of 363.46 g/mol. Its IUPAC name is (5Z)-5-(1-anilinoethylidene)-4-methylidene-2,3-diphenylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-(1-anilinoethylidene)-4-methylidene-2,3-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10451361 |
| Molecular Formula | C26H21NO |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (5Z)-5-(1-anilinoethylidene)-4-methylidene-2,3-diphenylcyclopent-2-en-1-one |
| SMILES | C=C1C(c2ccccc2)=C(c2ccccc2)C(=O)/C1=C(/C)Nc1ccccc1 |
| InChI | InChI=1S/C26H21NO/c1-18-23(19(2)27-22-16-10-5-11-17-22)26(28)25(21-14-8-4-9-15-21)24(18)20-12-6-3-7-13-20/h3-17,27H,1H2,2H3/b23-19- |
| InChIKey | IMMPKULMANPCEW-NMWGTECJSA-N |
| XLogP | 6.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|