C14H24N2O3S — CID 104517902
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1,1-dioxothiane-2-carboxamide (PubChem CID 104517902) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104517902 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(NC1CC[C@H]2CNC[C@H]2C1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H24N2O3S/c17-14(13-3-1-2-6-20(13,18)19)16-12-5-4-10-8-15-9-11(10)7-12/h10-13,15H,1-9H2,(H,16,17)/t10-,11+,12?,13?/m0/s1 |
| InChIKey | LENFLCUXEHDSLW-ZFDZMSFRSA-N |
| XLogP | 0.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |