C13H23N3O3S2 — CID 104519421
N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-1,1-dioxothiane-2-carboxamide (PubChem CID 104519421) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519421 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[1-(2-amino-2-sulfanylideneethyl)piperidin-4-yl]-1,1-dioxothiane-2-carboxamide |
| SMILES | NC(=S)CN1CCC(NC(=O)C2CCCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C13H23N3O3S2/c14-12(20)9-16-6-4-10(5-7-16)15-13(17)11-3-1-2-8-21(11,18)19/h10-11H,1-9H2,(H2,14,20)(H,15,17) |
| InChIKey | MQDCZHKXLFUVPE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|