C12H20N4 — CID 104535638
5-N-(2,6-dimethylpiperidin-1-yl)pyridine-3,5-diamine (PubChem CID 104535638) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-N-(2,6-dimethylpiperidin-1-yl)pyridine-3,5-diamine.
| Compound Name | 5-N-(2,6-dimethylpiperidin-1-yl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104535638 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 5-N-(2,6-dimethylpiperidin-1-yl)pyridine-3,5-diamine |
| SMILES | CC1CCCC(C)N1Nc1cncc(N)c1 |
| InChI | InChI=1S/C12H20N4/c1-9-4-3-5-10(2)16(9)15-12-6-11(13)7-14-8-12/h6-10,15H,3-5,13H2,1-2H3 |
| InChIKey | QOCSEQBKBPLAJR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |