C11H13NO2S — CID 104549044
2-(1-hydroxybutan-2-yl)-1,2-benzothiazol-3-one (PubChem CID 104549044) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(1-hydroxybutan-2-yl)-1,2-benzothiazol-3-one.
| Compound Name | 2-(1-hydroxybutan-2-yl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 104549044 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-(1-hydroxybutan-2-yl)-1,2-benzothiazol-3-one |
| SMILES | CCC(CO)n1sc2ccccc2c1=O |
| InChI | InChI=1S/C11H13NO2S/c1-2-8(7-13)12-11(14)9-5-3-4-6-10(9)15-12/h3-6,8,13H,2,7H2,1H3 |
| InChIKey | ZGRGZMQWYAHETG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |