(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid

C15H11NO3S — CID 51342245

IUPAC(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid
SMILESO=C(O)[C@H](c1ccccc1)n1sc2ccccc2c1=O
InChIInChI=1S/C15H11NO3S/c17-14-11-8-4-5-9-12(11)20-16(14)13(15(18)19)10-6-2-1-3-7-10/h1-9,13H,(H,18,19)/t13-/m0/s1
InChIKeyRLULBIWQZOAADG-ZDUSSCGKSA-N
MW285.32 g/mol
LogP2.74
Rot. Bonds3

About (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid

(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid (PubChem CID 51342245) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid.

Molecular Properties

Compound Name(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid
PubChem CID51342245
Molecular FormulaC15H11NO3S
Molecular Weight285.32 g/mol
Exact Mass285.05
IUPAC Name(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid
SMILESO=C(O)[C@H](c1ccccc1)n1sc2ccccc2c1=O
InChIInChI=1S/C15H11NO3S/c17-14-11-8-4-5-9-12(11)20-16(14)13(15(18)19)10-6-2-1-3-7-10/h1-9,13H,(H,18,19)/t13-/m0/s1
InChIKeyRLULBIWQZOAADG-ZDUSSCGKSA-N
XLogP2.74
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.32
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid?
The IUPAC name of (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid (CID 51342245) is (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid.
What is the SMILES notation for (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid?
The canonical SMILES for (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid is O=C(O)[C@H](c1ccccc1)n1sc2ccccc2c1=O.
What is the InChIKey of (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid?
The InChIKey is RLULBIWQZOAADG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H11NO3S/c17-14-11-8-4-5-9-12(11)20-16(14)13(15(18)19)10-6-2-1-3-7-10/h1-9,13H,(H,18,19)/t13-/m0/s1.
What are the key properties of (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid?
(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid has a molecular weight of 285.32 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid is sourced from PubChem (CID 51342245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).