C16H11NO2S — CID 640882
2-[(E)-3-phenylprop-2-enoyl]-1,2-benzothiazol-3-one (PubChem CID 640882) has the molecular formula C16H11NO2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(E)-3-phenylprop-2-enoyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[(E)-3-phenylprop-2-enoyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 640882 |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[(E)-3-phenylprop-2-enoyl]-1,2-benzothiazol-3-one |
| SMILES | O=C(/C=C/c1ccccc1)n1sc2ccccc2c1=O |
| InChI | InChI=1S/C16H11NO2S/c18-15(11-10-12-6-2-1-3-7-12)17-16(19)13-8-4-5-9-14(13)20-17/h1-11H/b11-10+ |
| InChIKey | KENQFMOVXVKJFA-ZHACJKMWSA-N |
| XLogP | 3.42 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|