C5H5F5N4 — CID 104605357
2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-amine (PubChem CID 104605357) has the molecular formula C5H5F5N4 and a molecular weight of 216.11 g/mol. Its IUPAC name is 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605357 |
| Molecular Formula | C5H5F5N4 |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)nc1N |
| InChI | InChI=1S/C5H5F5N4/c1-14-3(11)12-2(13-14)4(6,7)5(8,9)10/h1H3,(H2,11,12,13) |
| InChIKey | NPHXSBONSAQYRO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|