C14H10N2O5 — CID 104607120
5-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)furan-3-carboxylic acid (PubChem CID 104607120) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 5-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)furan-3-carboxylic acid.
| Compound Name | 5-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607120 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)furan-3-carboxylic acid |
| SMILES | O=C1CN(C(=O)c2cc(C(=O)O)co2)c2ccccc2N1 |
| InChI | InChI=1S/C14H10N2O5/c17-12-6-16(10-4-2-1-3-9(10)15-12)13(18)11-5-8(7-21-11)14(19)20/h1-5,7H,6H2,(H,15,17)(H,19,20) |
| InChIKey | OATQVZQNCRTIBD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |