C6H7F4N3O — CID 104632785
1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine (PubChem CID 104632785) has the molecular formula C6H7F4N3O and a molecular weight of 213.13 g/mol. Its IUPAC name is 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine.
| Compound Name | 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 104632785 |
| Molecular Formula | C6H7F4N3O |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 1-[5-(1,1,2,2-tetrafluoroethyl)-1,2,4-oxadiazol-3-yl]ethanamine |
| SMILES | CC(N)c1noc(C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C6H7F4N3O/c1-2(11)3-12-5(14-13-3)6(9,10)4(7)8/h2,4H,11H2,1H3 |
| InChIKey | PQZPWMBKSWALIB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|