C20H30N2O — CID 10470920
4,5-ditert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-2-one (PubChem CID 10470920) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-2-one.
| Compound Name | 4,5-ditert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-2-one |
|---|---|
| PubChem CID | 10470920 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 4,5-ditert-butyl-1-(2,6-dimethylphenyl)-3-methylimidazol-2-one |
| SMILES | Cc1cccc(C)c1-n1c(C(C)(C)C)c(C(C)(C)C)n(C)c1=O |
| InChI | InChI=1S/C20H30N2O/c1-13-11-10-12-14(2)15(13)22-17(20(6,7)8)16(19(3,4)5)21(9)18(22)23/h10-12H,1-9H3 |
| InChIKey | PGJUEFYUIUIGDP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |