C19H25BO2Si — CID 10471481
[(2S,4R)-4-(1,3,2-benzodioxaborol-2-yl)pentan-2-yl]-dimethyl-phenylsilane (PubChem CID 10471481) has the molecular formula C19H25BO2Si and a molecular weight of 324.31 g/mol. Its IUPAC name is [(2S,4R)-4-(1,3,2-benzodioxaborol-2-yl)pentan-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(2S,4R)-4-(1,3,2-benzodioxaborol-2-yl)pentan-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10471481 |
| Molecular Formula | C19H25BO2Si |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(2S,4R)-4-(1,3,2-benzodioxaborol-2-yl)pentan-2-yl]-dimethyl-phenylsilane |
| SMILES | C[C@H](C[C@H](C)[Si](C)(C)c1ccccc1)B1Oc2ccccc2O1 |
| InChI | InChI=1S/C19H25BO2Si/c1-15(20-21-18-12-8-9-13-19(18)22-20)14-16(2)23(3,4)17-10-6-5-7-11-17/h5-13,15-16H,14H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | WRRSLDIMONXCMB-CVEARBPZSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|