C17H18N2O2S2 — CID 10472826
1-piperidin-2-yl-3-thiophen-2-ylsulfonylindole (PubChem CID 10472826) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-piperidin-2-yl-3-thiophen-2-ylsulfonylindole.
| Compound Name | 1-piperidin-2-yl-3-thiophen-2-ylsulfonylindole |
|---|---|
| PubChem CID | 10472826 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-piperidin-2-yl-3-thiophen-2-ylsulfonylindole |
| SMILES | O=S(=O)(c1cccs1)c1cn(C2CCCCN2)c2ccccc12 |
| InChI | InChI=1S/C17H18N2O2S2/c20-23(21,17-9-5-11-22-17)15-12-19(16-8-3-4-10-18-16)14-7-2-1-6-13(14)15/h1-2,5-7,9,11-12,16,18H,3-4,8,10H2 |
| InChIKey | AQTDZBMVIMRYOM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |