C12H16N4O2 — CID 104731933
4-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]oxan-4-ol (PubChem CID 104731933) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]oxan-4-ol.
| Compound Name | 4-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 104731933 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNc2nccn3nccc23)CCOCC1 |
| InChI | InChI=1S/C12H16N4O2/c17-12(2-7-18-8-3-12)9-14-11-10-1-4-15-16(10)6-5-13-11/h1,4-6,17H,2-3,7-9H2,(H,13,14) |
| InChIKey | ODBNPJLFUHKXIV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |