C24H16N4O2 — CID 10475611
1-(2-methyl-1,8-naphthyridine-3-carbonyl)-3-naphthalen-2-ylpyrazole-4-carbaldehyde (PubChem CID 10475611) has the molecular formula C24H16N4O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-(2-methyl-1,8-naphthyridine-3-carbonyl)-3-naphthalen-2-ylpyrazole-4-carbaldehyde.
| Compound Name | 1-(2-methyl-1,8-naphthyridine-3-carbonyl)-3-naphthalen-2-ylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 10475611 |
| Molecular Formula | C24H16N4O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-(2-methyl-1,8-naphthyridine-3-carbonyl)-3-naphthalen-2-ylpyrazole-4-carbaldehyde |
| SMILES | Cc1nc2ncccc2cc1C(=O)n1cc(C=O)c(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C24H16N4O2/c1-15-21(12-19-7-4-10-25-23(19)26-15)24(30)28-13-20(14-29)22(27-28)18-9-8-16-5-2-3-6-17(16)11-18/h2-14H,1H3 |
| InChIKey | FATZYWXSBFHLAZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|