C23H46O5Si — CID 10477822
ethyl 3-hydroxy-12-(oxan-2-yloxy)-2-(trimethylsilylmethyl)dodecanoate (PubChem CID 10477822) has the molecular formula C23H46O5Si and a molecular weight of 430.70 g/mol. Its IUPAC name is ethyl 3-hydroxy-12-(oxan-2-yloxy)-2-(trimethylsilylmethyl)dodecanoate.
| Compound Name | ethyl 3-hydroxy-12-(oxan-2-yloxy)-2-(trimethylsilylmethyl)dodecanoate |
|---|---|
| PubChem CID | 10477822 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | ethyl 3-hydroxy-12-(oxan-2-yloxy)-2-(trimethylsilylmethyl)dodecanoate |
| SMILES | CCOC(=O)C(C[Si](C)(C)C)C(O)CCCCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C23H46O5Si/c1-5-26-23(25)20(19-29(2,3)4)21(24)15-11-9-7-6-8-10-13-17-27-22-16-12-14-18-28-22/h20-22,24H,5-19H2,1-4H3 |
| InChIKey | WJNLXXZYJKKIRS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|