C23H25Cl2FO2S — CID 10479145
[(2S,3S)-1,1-dichloro-1-fluoro-3-(4-methylphenyl)sulfanylhept-6-en-2-yl] (2S)-2-phenylpropanoate (PubChem CID 10479145) has the molecular formula C23H25Cl2FO2S and a molecular weight of 455.42 g/mol. Its IUPAC name is [(2S,3S)-1,1-dichloro-1-fluoro-3-(4-methylphenyl)sulfanylhept-6-en-2-yl] (2S)-2-phenylpropanoate.
| Compound Name | [(2S,3S)-1,1-dichloro-1-fluoro-3-(4-methylphenyl)sulfanylhept-6-en-2-yl] (2S)-2-phenylpropanoate |
|---|---|
| PubChem CID | 10479145 |
| Molecular Formula | C23H25Cl2FO2S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | [(2S,3S)-1,1-dichloro-1-fluoro-3-(4-methylphenyl)sulfanylhept-6-en-2-yl] (2S)-2-phenylpropanoate |
| SMILES | C=CCC[C@H](Sc1ccc(C)cc1)[C@H](OC(=O)[C@@H](C)c1ccccc1)C(F)(Cl)Cl |
| InChI | InChI=1S/C23H25Cl2FO2S/c1-4-5-11-20(29-19-14-12-16(2)13-15-19)21(23(24,25)26)28-22(27)17(3)18-9-7-6-8-10-18/h4,6-10,12-15,17,20-21H,1,5,11H2,2-3H3/t17-,20-,21-/m0/s1 |
| InChIKey | NCONNEXIMLFTSL-YYWHXJBOSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|