C21H22Cl3FO3S — CID 141229656
2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(2-hydroxyethyl)phenyl]methyl]butanoate (PubChem CID 141229656) has the molecular formula C21H22Cl3FO3S and a molecular weight of 479.83 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(2-hydroxyethyl)phenyl]methyl]butanoate.
| Compound Name | 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(2-hydroxyethyl)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 141229656 |
| Molecular Formula | C21H22Cl3FO3S |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(2-hydroxyethyl)phenyl]methyl]butanoate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)C(CCSc1ccc(F)cc1)Cc1ccc(CCO)cc1 |
| InChI | InChI=1S/C21H22Cl3FO3S/c22-21(23,24)14-28-20(27)17(10-12-29-19-7-5-18(25)6-8-19)13-16-3-1-15(2-4-16)9-11-26/h1-8,17,26H,9-14H2 |
| InChIKey | CUKXYZFDYBEGPY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|