C14H18ClN3O — CID 104816463
2-(2-chloro-6-methoxyphenyl)-2-(1,4-diazepan-1-yl)acetonitrile (PubChem CID 104816463) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxyphenyl)-2-(1,4-diazepan-1-yl)acetonitrile.
| Compound Name | 2-(2-chloro-6-methoxyphenyl)-2-(1,4-diazepan-1-yl)acetonitrile |
|---|---|
| PubChem CID | 104816463 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(2-chloro-6-methoxyphenyl)-2-(1,4-diazepan-1-yl)acetonitrile |
| SMILES | COc1cccc(Cl)c1C(C#N)N1CCCNCC1 |
| InChI | InChI=1S/C14H18ClN3O/c1-19-13-5-2-4-11(15)14(13)12(10-16)18-8-3-6-17-7-9-18/h2,4-5,12,17H,3,6-9H2,1H3 |
| InChIKey | FLDOFFHKOLOHSR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |