C15H21N3O2 — CID 61006490
2-(1,4-diazepan-1-yl)-2-(2,4-dimethoxyphenyl)acetonitrile (PubChem CID 61006490) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(2,4-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(2,4-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 61006490 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(2,4-dimethoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)N2CCCNCC2)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-19-12-4-5-13(15(10-12)20-2)14(11-16)18-8-3-6-17-7-9-18/h4-5,10,14,17H,3,6-9H2,1-2H3 |
| InChIKey | WRYTXKUJNLZBAM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |