C36H32O4S2 — CID 10483600
3-[[4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,5-dimethylphenyl)sulfanylchromen-2-one (PubChem CID 10483600) has the molecular formula C36H32O4S2 and a molecular weight of 592.78 g/mol. Its IUPAC name is 3-[[4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,5-dimethylphenyl)sulfanylchromen-2-one.
| Compound Name | 3-[[4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,5-dimethylphenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 10483600 |
| Molecular Formula | C36H32O4S2 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 3-[[4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,5-dimethylphenyl)sulfanylchromen-2-one |
| SMILES | C=C(C)/C=C(Sc1c(Cc2c(Sc3cc(C)ccc3C)c3ccccc3oc2=O)c(=O)oc2ccccc12)/C(C)=C\C |
| InChI | InChI=1S/C36H32O4S2/c1-7-23(5)31(18-21(2)3)41-33-25-12-8-10-14-29(25)39-35(37)27(33)20-28-34(42-32-19-22(4)16-17-24(32)6)26-13-9-11-15-30(26)40-36(28)38/h7-19H,2,20H2,1,3-6H3/b23-7-,31-18+ |
| InChIKey | SLIXTBPYBXJWKY-LHZSWYEESA-N |
| XLogP | 9.78 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|