C6H15N3O3S — CID 104873867
N'-hydroxy-3-(methanesulfonamido)-2,2-dimethylpropanimidamide (PubChem CID 104873867) has the molecular formula C6H15N3O3S and a molecular weight of 209.27 g/mol. Its IUPAC name is N'-hydroxy-3-(methanesulfonamido)-2,2-dimethylpropanimidamide.
| Compound Name | N'-hydroxy-3-(methanesulfonamido)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104873867 |
| Molecular Formula | C6H15N3O3S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N'-hydroxy-3-(methanesulfonamido)-2,2-dimethylpropanimidamide |
| SMILES | CC(C)(CNS(C)(=O)=O)C(N)=NO |
| InChI | InChI=1S/C6H15N3O3S/c1-6(2,5(7)9-10)4-8-13(3,11)12/h8,10H,4H2,1-3H3,(H2,7,9) |
| InChIKey | WCFCJIMKAPKUAB-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|