C7H6Cl2N6S — CID 104881890
1-amino-2-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)guanidine (PubChem CID 104881890) has the molecular formula C7H6Cl2N6S and a molecular weight of 277.14 g/mol. Its IUPAC name is 1-amino-2-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)guanidine.
| Compound Name | 1-amino-2-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)guanidine |
|---|---|
| PubChem CID | 104881890 |
| Molecular Formula | C7H6Cl2N6S |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 1-amino-2-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)guanidine |
| SMILES | NN/C(N)=N/c1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C7H6Cl2N6S/c8-2-1-3(9)5-6(15-16-14-5)4(2)12-7(10)13-11/h1H,11H2,(H3,10,12,13) |
| InChIKey | GHWMTUCGHJDSIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|