C7H7ClN6S — CID 116510535
1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine (PubChem CID 116510535) has the molecular formula C7H7ClN6S and a molecular weight of 242.69 g/mol. Its IUPAC name is 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine.
| Compound Name | 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
|---|---|
| PubChem CID | 116510535 |
| Molecular Formula | C7H7ClN6S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| SMILES | NN/C(N)=N/c1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C7H7ClN6S/c8-3-1-2-4-6(14-15-13-4)5(3)11-7(9)12-10/h1-2H,10H2,(H3,9,11,12) |
| InChIKey | BIADZQFLLWBZNT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|