About 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine
1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine (PubChem CID 116510535) has the molecular formula C7H7ClN6S
and a molecular weight of 242.69 g/mol. Its IUPAC name is 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine.
Molecular Properties
| Compound Name | 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| PubChem CID | 116510535 |
| Molecular Formula | C7H7ClN6S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| SMILES | NN/C(N)=N/c1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C7H7ClN6S/c8-3-1-2-4-6(14-15-13-4)5(3)11-7(9)12-10/h1-2H,10H2,(H3,9,11,12) |
| InChIKey | BIADZQFLLWBZNT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The IUPAC name of 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine (CID 116510535) is 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine.
What is the SMILES notation for 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The canonical SMILES for 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine is NN/C(N)=N/c1c(Cl)ccc2nsnc12.
What is the InChIKey of 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The InChIKey is BIADZQFLLWBZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN6S/c8-3-1-2-4-6(14-15-13-4)5(3)11-7(9)12-10/h1-2H,10H2,(H3,9,11,12).
What are the key properties of 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine has a molecular weight of 242.69 g/mol, XLogP of 0.75, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine is sourced from PubChem (CID 116510535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).