C7H7Br2ClN4 — CID 130484022
1-amino-2-(2,6-dibromo-4-chlorophenyl)guanidine (PubChem CID 130484022) has the molecular formula C7H7Br2ClN4 and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-amino-2-(2,6-dibromo-4-chlorophenyl)guanidine.
| Compound Name | 1-amino-2-(2,6-dibromo-4-chlorophenyl)guanidine |
|---|---|
| PubChem CID | 130484022 |
| Molecular Formula | C7H7Br2ClN4 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 339.87 |
| IUPAC Name | 1-amino-2-(2,6-dibromo-4-chlorophenyl)guanidine |
| SMILES | NN/C(N)=N/c1c(Br)cc(Cl)cc1Br |
| InChI | InChI=1S/C7H7Br2ClN4/c8-4-1-3(10)2-5(9)6(4)13-7(11)14-12/h1-2H,12H2,(H3,11,13,14) |
| InChIKey | OHEOSYJNEAYLFA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|