C10H16O4 — CID 10488246
(3aR,4R,6aR)-4-(dimethoxymethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]furan-5-one (PubChem CID 10488246) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-(dimethoxymethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]furan-5-one.
| Compound Name | (3aR,4R,6aR)-4-(dimethoxymethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 10488246 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3aR,4R,6aR)-4-(dimethoxymethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]furan-5-one |
| SMILES | COC(OC)[C@@H]1C(=O)C[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C10H16O4/c1-12-10(13-2)9-7-5-14-4-6(7)3-8(9)11/h6-7,9-10H,3-5H2,1-2H3/t6-,7+,9-/m0/s1 |
| InChIKey | SGTKPRQGVZEDIH-OOZYFLPDSA-N |
| XLogP | 0.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|