C10H19F3N4 — CID 104888054
1-amino-3-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine (PubChem CID 104888054) has the molecular formula C10H19F3N4 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine |
|---|---|
| PubChem CID | 104888054 |
| Molecular Formula | C10H19F3N4 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-(4,4,4-trifluorobutyl)guanidine |
| SMILES | NN/C(=N\CCCC(F)(F)F)NC1CCCC1 |
| InChI | InChI=1S/C10H19F3N4/c11-10(12,13)6-3-7-15-9(17-14)16-8-4-1-2-5-8/h8H,1-7,14H2,(H2,15,16,17) |
| InChIKey | BUPLMHSPVFNGHL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|