C14H14O3 — CID 10489622
3a-methyl-1,2,3,10a-tetrahydrocyclopenta[b][1]benzoxepine-4,5-dione (PubChem CID 10489622) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3a-methyl-1,2,3,10a-tetrahydrocyclopenta[b][1]benzoxepine-4,5-dione.
| Compound Name | 3a-methyl-1,2,3,10a-tetrahydrocyclopenta[b][1]benzoxepine-4,5-dione |
|---|---|
| PubChem CID | 10489622 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3a-methyl-1,2,3,10a-tetrahydrocyclopenta[b][1]benzoxepine-4,5-dione |
| SMILES | CC12CCCC1Oc1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C14H14O3/c1-14-8-4-7-11(14)17-10-6-3-2-5-9(10)12(15)13(14)16/h2-3,5-6,11H,4,7-8H2,1H3 |
| InChIKey | SUYPNGSQWYNWFC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|