C14H14O5 — CID 10934262
3,3-dimethoxy-4,4a-dihydropyrano[4,3-b]chromen-10-one (PubChem CID 10934262) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3,3-dimethoxy-4,4a-dihydropyrano[4,3-b]chromen-10-one.
| Compound Name | 3,3-dimethoxy-4,4a-dihydropyrano[4,3-b]chromen-10-one |
|---|---|
| PubChem CID | 10934262 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3,3-dimethoxy-4,4a-dihydropyrano[4,3-b]chromen-10-one |
| SMILES | COC1(OC)CC2Oc3ccccc3C(=O)C2=CO1 |
| InChI | InChI=1S/C14H14O5/c1-16-14(17-2)7-12-10(8-18-14)13(15)9-5-3-4-6-11(9)19-12/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | PXZRZDONSXXMOT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|