C15H21NO4 — CID 104962444
(1S,6R)-6-(3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 104962444) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (1S,6R)-6-(3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 104962444 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (1S,6R)-6-(3-hydroxy-8-azabicyclo[3.2.1]octane-8-carbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C15H21NO4/c17-11-7-9-5-6-10(8-11)16(9)14(18)12-3-1-2-4-13(12)15(19)20/h1-2,9-13,17H,3-8H2,(H,19,20)/t9?,10?,11?,12-,13+/m1/s1 |
| InChIKey | LUAKSOCJMTWEHW-BKZIUTAZSA-N |
| XLogP | 1.17 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|