C19H26N2O3 — CID 10496670
(E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-imine (PubChem CID 10496670) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-imine.
| Compound Name | (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 10496670 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (E,2S,4R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-imine |
| SMILES | C=CC[C@H]1O[C@@H](c2ccccc2)OC/C1=N\N1CCC[C@@H]1COC |
| InChI | InChI=1S/C19H26N2O3/c1-3-8-18-17(20-21-12-7-11-16(21)13-22-2)14-23-19(24-18)15-9-5-4-6-10-15/h3-6,9-10,16,18-19H,1,7-8,11-14H2,2H3/b20-17+/t16-,18-,19+/m1/s1 |
| InChIKey | BGCJMOQCTLDFRO-UIKDZAAUSA-N |
| XLogP | 3.14 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|