C17H30INO3 — CID 104969710
tert-butyl 3-(3,5-dimethylcyclohexyl)oxy-4-iodopyrrolidine-1-carboxylate (PubChem CID 104969710) has the molecular formula C17H30INO3 and a molecular weight of 423.34 g/mol. Its IUPAC name is tert-butyl 3-(3,5-dimethylcyclohexyl)oxy-4-iodopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3,5-dimethylcyclohexyl)oxy-4-iodopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 104969710 |
| Molecular Formula | C17H30INO3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | tert-butyl 3-(3,5-dimethylcyclohexyl)oxy-4-iodopyrrolidine-1-carboxylate |
| SMILES | CC1CC(C)CC(OC2CN(C(=O)OC(C)(C)C)CC2I)C1 |
| InChI | InChI=1S/C17H30INO3/c1-11-6-12(2)8-13(7-11)21-15-10-19(9-14(15)18)16(20)22-17(3,4)5/h11-15H,6-10H2,1-5H3 |
| InChIKey | GRSGNSWRWNPRBW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|