C14H23BrF3NO3 — CID 104969729
tert-butyl 3-(bromomethyl)-3-(1,1,1-trifluoropropan-2-yloxy)piperidine-1-carboxylate (PubChem CID 104969729) has the molecular formula C14H23BrF3NO3 and a molecular weight of 390.24 g/mol. Its IUPAC name is tert-butyl 3-(bromomethyl)-3-(1,1,1-trifluoropropan-2-yloxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(bromomethyl)-3-(1,1,1-trifluoropropan-2-yloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104969729 |
| Molecular Formula | C14H23BrF3NO3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | tert-butyl 3-(bromomethyl)-3-(1,1,1-trifluoropropan-2-yloxy)piperidine-1-carboxylate |
| SMILES | CC(OC1(CBr)CCCN(C(=O)OC(C)(C)C)C1)C(F)(F)F |
| InChI | InChI=1S/C14H23BrF3NO3/c1-10(14(16,17)18)21-13(8-15)6-5-7-19(9-13)11(20)22-12(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | CNEZLBQTTVEYNV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|