C16H30INO4 — CID 165492993
tert-butyl 3-(iodomethyl)-3-(2-methoxy-2-methylpropoxy)piperidine-1-carboxylate (PubChem CID 165492993) has the molecular formula C16H30INO4 and a molecular weight of 427.32 g/mol. Its IUPAC name is tert-butyl 3-(iodomethyl)-3-(2-methoxy-2-methylpropoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(iodomethyl)-3-(2-methoxy-2-methylpropoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165492993 |
| Molecular Formula | C16H30INO4 |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | tert-butyl 3-(iodomethyl)-3-(2-methoxy-2-methylpropoxy)piperidine-1-carboxylate |
| SMILES | COC(C)(C)COC1(CI)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30INO4/c1-14(2,3)22-13(19)18-9-7-8-16(10-17,11-18)21-12-15(4,5)20-6/h7-12H2,1-6H3 |
| InChIKey | NGIATBIOIGATOL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|