C16H30N2O6 — CID 10497774
(2S)-N-(10-aminodecyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide (PubChem CID 10497774) has the molecular formula C16H30N2O6 and a molecular weight of 346.42 g/mol. Its IUPAC name is (2S)-N-(10-aminodecyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide.
| Compound Name | (2S)-N-(10-aminodecyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 10497774 |
| Molecular Formula | C16H30N2O6 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2S)-N-(10-aminodecyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide |
| SMILES | NCCCCCCCCCCNC(=O)[C@@H](O)[C@H]1OC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30N2O6/c17-9-7-5-3-1-2-4-6-8-10-18-15(22)13(21)14-11(19)12(20)16(23)24-14/h11-14,19-21H,1-10,17H2,(H,18,22)/t11-,12-,13+,14+/m1/s1 |
| InChIKey | SSWQVADDQKQMIS-MQYQWHSLSA-N |
| XLogP | -0.81 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|