C10H18N2O6 — CID 10563404
(2S)-N-(4-aminobutyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide (PubChem CID 10563404) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2S)-N-(4-aminobutyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide.
| Compound Name | (2S)-N-(4-aminobutyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 10563404 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2S)-N-(4-aminobutyl)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetamide |
| SMILES | NCCCCNC(=O)[C@@H](O)[C@H]1OC(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18N2O6/c11-3-1-2-4-12-9(16)7(15)8-5(13)6(14)10(17)18-8/h5-8,13-15H,1-4,11H2,(H,12,16)/t5-,6-,7+,8+/m1/s1 |
| InChIKey | ZMIKQXVPXNFTAH-NGJRWZKOSA-N |
| XLogP | -3.15 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|