C16H29N3O4 — CID 104979066
tert-butyl 3-(aminomethyl)-4-(5-methyloxolane-3-carbonyl)piperazine-1-carboxylate (PubChem CID 104979066) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-4-(5-methyloxolane-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-4-(5-methyloxolane-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104979066 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-4-(5-methyloxolane-3-carbonyl)piperazine-1-carboxylate |
| SMILES | CC1CC(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2CN)CO1 |
| InChI | InChI=1S/C16H29N3O4/c1-11-7-12(10-22-11)14(20)19-6-5-18(9-13(19)8-17)15(21)23-16(2,3)4/h11-13H,5-10,17H2,1-4H3 |
| InChIKey | GZABQVVEJQZTQQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |