C16H25N3O4 — CID 104978889
tert-butyl 3-(aminomethyl)-4-(5-methylfuran-3-carbonyl)piperazine-1-carboxylate (PubChem CID 104978889) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 3-(aminomethyl)-4-(5-methylfuran-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(aminomethyl)-4-(5-methylfuran-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104978889 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl 3-(aminomethyl)-4-(5-methylfuran-3-carbonyl)piperazine-1-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2CN)co1 |
| InChI | InChI=1S/C16H25N3O4/c1-11-7-12(10-22-11)14(20)19-6-5-18(9-13(19)8-17)15(21)23-16(2,3)4/h7,10,13H,5-6,8-9,17H2,1-4H3 |
| InChIKey | KHWCGQMTCLZMRQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |