C16H24Cl3NO — CID 10498228
1,1-dichloro-N-[(E)-2-chloro-9-(3,3-dimethyloxiran-2-yl)-7-methyl-3-methylidenenon-6-enyl]methanimine (PubChem CID 10498228) has the molecular formula C16H24Cl3NO and a molecular weight of 352.73 g/mol. Its IUPAC name is 1,1-dichloro-N-[(E)-2-chloro-9-(3,3-dimethyloxiran-2-yl)-7-methyl-3-methylidenenon-6-enyl]methanimine.
| Compound Name | 1,1-dichloro-N-[(E)-2-chloro-9-(3,3-dimethyloxiran-2-yl)-7-methyl-3-methylidenenon-6-enyl]methanimine |
|---|---|
| PubChem CID | 10498228 |
| Molecular Formula | C16H24Cl3NO |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1,1-dichloro-N-[(E)-2-chloro-9-(3,3-dimethyloxiran-2-yl)-7-methyl-3-methylidenenon-6-enyl]methanimine |
| SMILES | C=C(CC/C=C(\C)CCC1OC1(C)C)C(Cl)CN=C(Cl)Cl |
| InChI | InChI=1S/C16H24Cl3NO/c1-11(8-9-14-16(3,4)21-14)6-5-7-12(2)13(17)10-20-15(18)19/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+ |
| InChIKey | SGSUCMPCVPXNFI-IZZDOVSWSA-N |
| XLogP | 5.67 |
| TPSA | 24.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|