C20H27NO8 — CID 10501653
methyl (2S)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[acetyloxy(benzyl)amino]acetate (PubChem CID 10501653) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl (2S)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[acetyloxy(benzyl)amino]acetate.
| Compound Name | methyl (2S)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[acetyloxy(benzyl)amino]acetate |
|---|---|
| PubChem CID | 10501653 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | methyl (2S)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[acetyloxy(benzyl)amino]acetate |
| SMILES | COC(=O)[C@H]([C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21)N(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H27NO8/c1-12(22)29-21(11-13-9-7-6-8-10-13)14(18(23)24-4)15-16-17(19(25-5)26-15)28-20(2,3)27-16/h6-10,14-17,19H,11H2,1-5H3/t14-,15+,16+,17+,19+/m0/s1 |
| InChIKey | YXDBEWVVYVWGAX-SEFVSHJNSA-N |
| XLogP | 1.40 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|