C23H31NO9 — CID 10504361
methyl (2R)-2-[acetyloxy(benzyl)amino]-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate (PubChem CID 10504361) has the molecular formula C23H31NO9 and a molecular weight of 465.50 g/mol. Its IUPAC name is methyl (2R)-2-[acetyloxy(benzyl)amino]-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate.
| Compound Name | methyl (2R)-2-[acetyloxy(benzyl)amino]-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
|---|---|
| PubChem CID | 10504361 |
| Molecular Formula | C23H31NO9 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | methyl (2R)-2-[acetyloxy(benzyl)amino]-2-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
| SMILES | COC(=O)[C@@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C23H31NO9/c1-13(25)33-24(12-14-10-8-7-9-11-14)15(20(26)27-6)16-17-18(30-22(2,3)29-17)19-21(28-16)32-23(4,5)31-19/h7-11,15-19,21H,12H2,1-6H3/t15-,16-,17+,18+,19-,21-/m1/s1 |
| InChIKey | BKZVEVOIQOWUQK-HDZJJSNZSA-N |
| XLogP | 1.90 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|