C26H19NO8 — CID 10504657
2'-benzyl-6',7'-dimethoxyspiro[furo[3,4-f][1,3]benzodioxole-7,3'-isoquinoline]-1',4',5-trione (PubChem CID 10504657) has the molecular formula C26H19NO8 and a molecular weight of 473.44 g/mol. Its IUPAC name is 2'-benzyl-6',7'-dimethoxyspiro[furo[3,4-f][1,3]benzodioxole-7,3'-isoquinoline]-1',4',5-trione.
| Compound Name | 2'-benzyl-6',7'-dimethoxyspiro[furo[3,4-f][1,3]benzodioxole-7,3'-isoquinoline]-1',4',5-trione |
|---|---|
| PubChem CID | 10504657 |
| Molecular Formula | C26H19NO8 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2'-benzyl-6',7'-dimethoxyspiro[furo[3,4-f][1,3]benzodioxole-7,3'-isoquinoline]-1',4',5-trione |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(OC(=O)c3cc4c(cc31)OCO4)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C26H19NO8/c1-31-19-8-15-16(9-20(19)32-2)24(29)27(12-14-6-4-3-5-7-14)26(23(15)28)18-11-22-21(33-13-34-22)10-17(18)25(30)35-26/h3-11H,12-13H2,1-2H3 |
| InChIKey | YSTYWVNDUZZYGA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |