C14H18BrNO3 — CID 105060151
N-(1-bromo-2-phenylpropan-2-yl)-1,4-dioxane-2-carboxamide (PubChem CID 105060151) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(1-bromo-2-phenylpropan-2-yl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(1-bromo-2-phenylpropan-2-yl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 105060151 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-(1-bromo-2-phenylpropan-2-yl)-1,4-dioxane-2-carboxamide |
| SMILES | CC(CBr)(NC(=O)C1COCCO1)c1ccccc1 |
| InChI | InChI=1S/C14H18BrNO3/c1-14(10-15,11-5-3-2-4-6-11)16-13(17)12-9-18-7-8-19-12/h2-6,12H,7-10H2,1H3,(H,16,17) |
| InChIKey | NSKSWFGKFVVHFX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|