C34H64O5Si2 — CID 10507933
[(1S)-1-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate (PubChem CID 10507933) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate.
| Compound Name | [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate |
|---|---|
| PubChem CID | 10507933 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)non-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H](CC=C)[C@@H]1C[C@H]1[C@@H](/C=C/[C@@H](CCCCC)O[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C34H64O5Si2/c1-12-15-17-20-28(39-41(10,11)34(4,5)6)22-23-31(37-27-36-24-25-40(7,8)9)29-26-30(29)32(19-14-3)38-33(35)21-18-16-13-2/h13-14,22-23,28-32H,2-3,12,15-21,24-27H2,1,4-11H3/b23-22+/t28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | UNDBOMKAQZXKHS-HQRBJIDSSA-N |
| XLogP | 9.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|