C36H70O10Si2 — CID 10604912
[(2E,4S,5S,8S,9S,12S,13S,14E)-12-acetyloxy-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,13-bis(methoxymethoxy)hexadeca-2,14-dien-5-yl] acetate (PubChem CID 10604912) has the molecular formula C36H70O10Si2 and a molecular weight of 719.12 g/mol. Its IUPAC name is [(2E,4S,5S,8S,9S,12S,13S,14E)-12-acetyloxy-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,13-bis(methoxymethoxy)hexadeca-2,14-dien-5-yl] acetate.
| Compound Name | [(2E,4S,5S,8S,9S,12S,13S,14E)-12-acetyloxy-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,13-bis(methoxymethoxy)hexadeca-2,14-dien-5-yl] acetate |
|---|---|
| PubChem CID | 10604912 |
| Molecular Formula | C36H70O10Si2 |
| Molecular Weight | 719.12 g/mol |
| Exact Mass | 718.45 |
| IUPAC Name | [(2E,4S,5S,8S,9S,12S,13S,14E)-12-acetyloxy-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-4,13-bis(methoxymethoxy)hexadeca-2,14-dien-5-yl] acetate |
| SMILES | C/C=C/[C@H](OCOC)[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC[C@H](OC(C)=O)[C@H](/C=C/C)OCOC)O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C36H70O10Si2/c1-17-19-29(41-25-39-11)31(43-27(3)37)21-23-33(45-47(13,14)35(5,6)7)34(46-48(15,16)36(8,9)10)24-22-32(44-28(4)38)30(20-18-2)42-26-40-12/h17-20,29-34H,21-26H2,1-16H3/b19-17+,20-18+/t29-,30-,31-,32-,33-,34-/m0/s1 |
| InChIKey | FDVPOJFGQLWQDY-OAIWKHJTSA-N |
| XLogP | 8.32 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.12 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|