C26H40O6 — CID 11419508
[(1S)-1-[(1R,2R)-2-[(E,1R,4R)-1,4-diacetyloxynon-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate (PubChem CID 11419508) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-1,4-diacetyloxynon-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate.
| Compound Name | [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-1,4-diacetyloxynon-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate |
|---|---|
| PubChem CID | 11419508 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [(1S)-1-[(1R,2R)-2-[(E,1R,4R)-1,4-diacetyloxynon-2-enyl]cyclopropyl]but-3-enyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H](CC=C)[C@@H]1C[C@H]1[C@@H](/C=C/[C@@H](CCCCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H40O6/c1-6-9-11-14-21(30-19(4)27)16-17-25(31-20(5)28)23-18-22(23)24(13-8-3)32-26(29)15-12-10-7-2/h7-8,16-17,21-25H,2-3,6,9-15,18H2,1,4-5H3/b17-16+/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | CFDGBAQKFWXKCX-YGRHOLAXSA-N |
| XLogP | 5.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|