C10H6Cl2N2OS — CID 105088259
2-(2,4-dichlorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethanone (PubChem CID 105088259) has the molecular formula C10H6Cl2N2OS and a molecular weight of 273.14 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethanone |
|---|---|
| PubChem CID | 105088259 |
| Molecular Formula | C10H6Cl2N2OS |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1cnsn1 |
| InChI | InChI=1S/C10H6Cl2N2OS/c11-7-2-1-6(8(12)4-7)3-10(15)9-5-13-16-14-9/h1-2,4-5H,3H2 |
| InChIKey | YWFCQNQJZNWZIR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |