C15H18N2O3S — CID 105096318
(3,4-diethoxyphenyl)-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 105096318) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(4-ethylthiadiazol-5-yl)methanone.
| Compound Name | (3,4-diethoxyphenyl)-(4-ethylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 105096318 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3,4-diethoxyphenyl)-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCOc1ccc(C(=O)c2snnc2CC)cc1OCC |
| InChI | InChI=1S/C15H18N2O3S/c1-4-11-15(21-17-16-11)14(18)10-7-8-12(19-5-2)13(9-10)20-6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | XZSKQVWHAPDRQU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |