C15H28OS — CID 105102794
1-(3,5-dimethylcyclohexyl)-2-(thian-4-yl)ethanol (PubChem CID 105102794) has the molecular formula C15H28OS and a molecular weight of 256.45 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-(thian-4-yl)ethanol.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-(thian-4-yl)ethanol |
|---|---|
| PubChem CID | 105102794 |
| Molecular Formula | C15H28OS |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-(thian-4-yl)ethanol |
| SMILES | CC1CC(C)CC(C(O)CC2CCSCC2)C1 |
| InChI | InChI=1S/C15H28OS/c1-11-7-12(2)9-14(8-11)15(16)10-13-3-5-17-6-4-13/h11-16H,3-10H2,1-2H3 |
| InChIKey | HGDWIVKUJVZEIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |